C23H23F3N2O7S2 — CID 51049516
(2S)-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxyphenyl]-2-(2,2,2-trifluoroethylsulfonylamino)propanoic acid (PubChem CID 51049516) has the molecular formula C23H23F3N2O7S2 and a molecular weight of 560.57 g/mol. Its IUPAC name is (2S)-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxyphenyl]-2-(2,2,2-trifluoroethylsulfonylamino)propanoic acid.
| Compound Name | (2S)-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxyphenyl]-2-(2,2,2-trifluoroethylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 51049516 |
| Molecular Formula | C23H23F3N2O7S2 |
| Molecular Weight | 560.57 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | (2S)-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxyphenyl]-2-(2,2,2-trifluoroethylsulfonylamino)propanoic acid |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)Oc3ccc(C[C@H](NS(=O)(=O)CC(F)(F)F)C(=O)O)cc3)cccc12 |
| InChI | InChI=1S/C23H23F3N2O7S2/c1-28(2)20-7-3-6-18-17(20)5-4-8-21(18)37(33,34)35-16-11-9-15(10-12-16)13-19(22(29)30)27-36(31,32)14-23(24,25)26/h3-12,19,27H,13-14H2,1-2H3,(H,29,30)/t19-/m0/s1 |
| InChIKey | LLFGAZISNNWFKT-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|