C6H11F2NO2 — CID 51049977
(3R,4R,5S)-5-(difluoromethyl)piperidine-3,4-diol (PubChem CID 51049977) has the molecular formula C6H11F2NO2 and a molecular weight of 167.15 g/mol. Its IUPAC name is (3R,4R,5S)-5-(difluoromethyl)piperidine-3,4-diol.
| Compound Name | (3R,4R,5S)-5-(difluoromethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 51049977 |
| Molecular Formula | C6H11F2NO2 |
| Molecular Weight | 167.15 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | (3R,4R,5S)-5-(difluoromethyl)piperidine-3,4-diol |
| SMILES | O[C@H]1[C@H](O)CNC[C@@H]1C(F)F |
| InChI | InChI=1S/C6H11F2NO2/c7-6(8)3-1-9-2-4(10)5(3)11/h3-6,9-11H,1-2H2/t3-,4+,5+/m0/s1 |
| InChIKey | QSMPJEGWIQSKCL-VPENINKCSA-N |
| XLogP | -0.81 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.15 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |