About 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide
1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide (PubChem CID 51050007) has the molecular formula C11H9F3N4O
and a molecular weight of 270.21 g/mol. Its IUPAC name is 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide |
| PubChem CID | 51050007 |
| Molecular Formula | C11H9F3N4O |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1cnn(-c2cccnc2)c1 |
| InChI | InChI=1S/C11H9F3N4O/c12-11(13,14)7-16-10(19)8-4-17-18(6-8)9-2-1-3-15-5-9/h1-6H,7H2,(H,16,19) |
| InChIKey | ZATBUYALDPAKHC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide?
The IUPAC name of 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide (CID 51050007) is 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide.
What is the SMILES notation for 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide?
The canonical SMILES for 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide is O=C(NCC(F)(F)F)c1cnn(-c2cccnc2)c1.
What is the InChIKey of 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide?
The InChIKey is ZATBUYALDPAKHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N4O/c12-11(13,14)7-16-10(19)8-4-17-18(6-8)9-2-1-3-15-5-9/h1-6H,7H2,(H,16,19).
What are the key properties of 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide?
1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide has a molecular weight of 270.21 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-3-yl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide is sourced from PubChem (CID 51050007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).