C16H13N3O2 — CID 51050039
N-[(1S,2R)-2-phenylcyclopropyl]-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 51050039) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-[(1S,2R)-2-phenylcyclopropyl]-2,1,3-benzoxadiazole-5-carboxamide.
| Compound Name | N-[(1S,2R)-2-phenylcyclopropyl]-2,1,3-benzoxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 51050039 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-[(1S,2R)-2-phenylcyclopropyl]-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | O=C(N[C@H]1C[C@@H]1c1ccccc1)c1ccc2nonc2c1 |
| InChI | InChI=1S/C16H13N3O2/c20-16(11-6-7-13-15(8-11)19-21-18-13)17-14-9-12(14)10-4-2-1-3-5-10/h1-8,12,14H,9H2,(H,17,20)/t12-,14+/m1/s1 |
| InChIKey | XLYDBSIMZKYIRB-OCCSQVGLSA-N |
| XLogP | 2.51 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |