C13H24N2O4 — CID 51050043
tert-butyl N-[(2S)-1-[[(2S)-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 51050043) has the molecular formula C13H24N2O4 and a molecular weight of 272.35 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 51050043 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](C=O)NC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24N2O4/c1-8(2)10(7-16)15-11(17)9(3)14-12(18)19-13(4,5)6/h7-10H,1-6H3,(H,14,18)(H,15,17)/t9-,10+/m0/s1 |
| InChIKey | KYZDSEQCSIMMSH-VHSXEESVSA-N |
| XLogP | 1.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|