C20H30O5 — CID 51050060
(2R,4aR,9aR)-6-(2-methoxyethoxymethoxy)-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol (PubChem CID 51050060) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2R,4aR,9aR)-6-(2-methoxyethoxymethoxy)-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol.
| Compound Name | (2R,4aR,9aR)-6-(2-methoxyethoxymethoxy)-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol |
|---|---|
| PubChem CID | 51050060 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (2R,4aR,9aR)-6-(2-methoxyethoxymethoxy)-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol |
| SMILES | COCCOCOc1ccc2c(c1)O[C@]1(C)CC[C@@H](O)C(C)(C)[C@H]1C2 |
| InChI | InChI=1S/C20H30O5/c1-19(2)17-11-14-5-6-15(24-13-23-10-9-22-4)12-16(14)25-20(17,3)8-7-18(19)21/h5-6,12,17-18,21H,7-11,13H2,1-4H3/t17-,18-,20-/m1/s1 |
| InChIKey | SJGZLANRRFWUJJ-QWFCFKBJSA-N |
| XLogP | 3.18 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|