C22H19NO3S — CID 51050070
(E)-3-(benzenesulfonyl)-N-methyl-N,3-diphenylprop-2-enamide (PubChem CID 51050070) has the molecular formula C22H19NO3S and a molecular weight of 377.47 g/mol. Its IUPAC name is (E)-3-(benzenesulfonyl)-N-methyl-N,3-diphenylprop-2-enamide.
| Compound Name | (E)-3-(benzenesulfonyl)-N-methyl-N,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 51050070 |
| Molecular Formula | C22H19NO3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (E)-3-(benzenesulfonyl)-N-methyl-N,3-diphenylprop-2-enamide |
| SMILES | CN(C(=O)/C=C(\c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO3S/c1-23(19-13-7-3-8-14-19)22(24)17-21(18-11-5-2-6-12-18)27(25,26)20-15-9-4-10-16-20/h2-17H,1H3/b21-17+ |
| InChIKey | KQMYBMZUBAZUSP-HEHNFIMWSA-N |
| XLogP | 4.16 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|