About tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate
tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate (PubChem CID 51050405) has the molecular formula C20H24N6O3
and a molecular weight of 396.45 g/mol. Its IUPAC name is tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate |
| PubChem CID | 51050405 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(-c3nnc(-c4ccccc4)o3)nn2)CC1 |
| InChI | InChI=1S/C20H24N6O3/c1-20(2,3)29-19(27)25-11-9-15(10-12-25)26-13-16(21-24-26)18-23-22-17(28-18)14-7-5-4-6-8-14/h4-8,13,15H,9-12H2,1-3H3 |
| InChIKey | XAFUZUWFTPXXAV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate (CID 51050405) is tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(n2cc(-c3nnc(-c4ccccc4)o3)nn2)CC1.
What is the InChIKey of tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate?
The InChIKey is XAFUZUWFTPXXAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6O3/c1-20(2,3)29-19(27)25-11-9-15(10-12-25)26-13-16(21-24-26)18-23-22-17(28-18)14-7-5-4-6-8-14/h4-8,13,15H,9-12H2,1-3H3.
What are the key properties of tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate?
tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate has a molecular weight of 396.45 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidine-1-carboxylate is sourced from PubChem (CID 51050405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).