C18H19NO2 — CID 51050415
(3S)-3,4-dibenzylmorpholin-2-one (PubChem CID 51050415) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (3S)-3,4-dibenzylmorpholin-2-one.
| Compound Name | (3S)-3,4-dibenzylmorpholin-2-one |
|---|---|
| PubChem CID | 51050415 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3S)-3,4-dibenzylmorpholin-2-one |
| SMILES | O=C1OCCN(Cc2ccccc2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c20-18-17(13-15-7-3-1-4-8-15)19(11-12-21-18)14-16-9-5-2-6-10-16/h1-10,17H,11-14H2/t17-/m0/s1 |
| InChIKey | AWDZTSVNWRAROK-KRWDZBQOSA-N |
| XLogP | 2.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |