About 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one
7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one (PubChem CID 51050608) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one.
Molecular Properties
| Compound Name | 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one |
| PubChem CID | 51050608 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one |
| SMILES | CC1=CC=C(C)C2(OCCO2)C1=O |
| InChI | InChI=1S/C10H12O3/c1-7-3-4-8(2)10(9(7)11)12-5-6-13-10/h3-4H,5-6H2,1-2H3 |
| InChIKey | ONNRBLLRFQJFIY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one?
The IUPAC name of 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one (CID 51050608) is 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one.
What is the SMILES notation for 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one?
The canonical SMILES for 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one is CC1=CC=C(C)C2(OCCO2)C1=O.
What is the InChIKey of 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one?
The InChIKey is ONNRBLLRFQJFIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-7-3-4-8(2)10(9(7)11)12-5-6-13-10/h3-4H,5-6H2,1-2H3.
What are the key properties of 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one?
7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one has a molecular weight of 180.20 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,10-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one is sourced from PubChem (CID 51050608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).