C15H7F5O — CID 51050774
3-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1-benzofuran (PubChem CID 51050774) has the molecular formula C15H7F5O and a molecular weight of 298.21 g/mol. Its IUPAC name is 3-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1-benzofuran.
| Compound Name | 3-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1-benzofuran |
|---|---|
| PubChem CID | 51050774 |
| Molecular Formula | C15H7F5O |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1-benzofuran |
| SMILES | Cc1c(-c2c(F)c(F)c(F)c(F)c2F)oc2ccccc12 |
| InChI | InChI=1S/C15H7F5O/c1-6-7-4-2-3-5-8(7)21-15(6)9-10(16)12(18)14(20)13(19)11(9)17/h2-5H,1H3 |
| InChIKey | WMHJMYFIUDKKLL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|