C16H34O5Si — CID 51050895
(2S,3R,6S,7R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(hydroxymethyl)-2,7-dimethyloxepane-3,6-diol (PubChem CID 51050895) has the molecular formula C16H34O5Si and a molecular weight of 334.53 g/mol. Its IUPAC name is (2S,3R,6S,7R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(hydroxymethyl)-2,7-dimethyloxepane-3,6-diol.
| Compound Name | (2S,3R,6S,7R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(hydroxymethyl)-2,7-dimethyloxepane-3,6-diol |
|---|---|
| PubChem CID | 51050895 |
| Molecular Formula | C16H34O5Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | (2S,3R,6S,7R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(hydroxymethyl)-2,7-dimethyloxepane-3,6-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(C)O[C@](C)(CO)[C@@H](O)CC[C@H]1O |
| InChI | InChI=1S/C16H34O5Si/c1-14(2,3)22(6,7)20-11-16(5)13(19)9-8-12(18)15(4,10-17)21-16/h12-13,17-19H,8-11H2,1-7H3/t12-,13+,15+,16-/m0/s1 |
| InChIKey | OGLPUPLYMLTCHJ-XNISGKROSA-N |
| XLogP | 2.05 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|