C17H22N8O2 — CID 51050943
1-[4-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]piperazin-1-yl]pentan-1-one (PubChem CID 51050943) has the molecular formula C17H22N8O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is 1-[4-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]piperazin-1-yl]pentan-1-one.
| Compound Name | 1-[4-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 51050943 |
| Molecular Formula | C17H22N8O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[4-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]piperazin-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCN(c2nc(N)n3nc(-c4ccco4)nc3n2)CC1 |
| InChI | InChI=1S/C17H22N8O2/c1-2-3-6-13(26)23-7-9-24(10-8-23)16-20-15(18)25-17(21-16)19-14(22-25)12-5-4-11-27-12/h4-5,11H,2-3,6-10H2,1H3,(H2,18,19,20,21,22) |
| InChIKey | AVZWWPOOFMSQRF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |