C21H30O4 — CID 51050983
methyl (2E,4E)-6-[(2R,3S,6S,8R,9S)-2-ethynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-4-methylhexa-2,4-dienoate (PubChem CID 51050983) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl (2E,4E)-6-[(2R,3S,6S,8R,9S)-2-ethynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-4-methylhexa-2,4-dienoate.
| Compound Name | methyl (2E,4E)-6-[(2R,3S,6S,8R,9S)-2-ethynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-4-methylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 51050983 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | methyl (2E,4E)-6-[(2R,3S,6S,8R,9S)-2-ethynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-4-methylhexa-2,4-dienoate |
| SMILES | C#C[C@@H]1O[C@]2(CC[C@@H]1C)CC[C@H](C)[C@@H](C/C=C(C)/C=C/C(=O)OC)O2 |
| InChI | InChI=1S/C21H30O4/c1-6-18-16(3)11-13-21(24-18)14-12-17(4)19(25-21)9-7-15(2)8-10-20(22)23-5/h1,7-8,10,16-19H,9,11-14H2,2-5H3/b10-8+,15-7+/t16-,17-,18-,19+,21-/m0/s1 |
| InChIKey | AORIQXXNLIKUDR-GKJGZMEUSA-N |
| XLogP | 4.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|