C20H13F3N2O5S — CID 51051024
4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-dimethoxyphenoxy]-2-(trifluoromethyl)benzonitrile (PubChem CID 51051024) has the molecular formula C20H13F3N2O5S and a molecular weight of 450.39 g/mol. Its IUPAC name is 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-dimethoxyphenoxy]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-dimethoxyphenoxy]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 51051024 |
| Molecular Formula | C20H13F3N2O5S |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-dimethoxyphenoxy]-2-(trifluoromethyl)benzonitrile |
| SMILES | COc1cc(/C=C2\SC(=O)NC2=O)cc(OC)c1Oc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H13F3N2O5S/c1-28-14-5-10(7-16-18(26)25-19(27)31-16)6-15(29-2)17(14)30-12-4-3-11(9-24)13(8-12)20(21,22)23/h3-8H,1-2H3,(H,25,26,27)/b16-7- |
| InChIKey | VZIIWAONOJFYIG-APSNUPSMSA-N |
| XLogP | 4.71 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|