C16H21BrO2 — CID 51051055
(2R,7Z,15E)-16-bromohexadeca-7,15-dien-3,5-diyne-1,2-diol (PubChem CID 51051055) has the molecular formula C16H21BrO2 and a molecular weight of 325.25 g/mol. Its IUPAC name is (2R,7Z,15E)-16-bromohexadeca-7,15-dien-3,5-diyne-1,2-diol.
| Compound Name | (2R,7Z,15E)-16-bromohexadeca-7,15-dien-3,5-diyne-1,2-diol |
|---|---|
| PubChem CID | 51051055 |
| Molecular Formula | C16H21BrO2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | (2R,7Z,15E)-16-bromohexadeca-7,15-dien-3,5-diyne-1,2-diol |
| SMILES | OC[C@H](O)C#CC#C/C=C\CCCCCC/C=C/Br |
| InChI | InChI=1S/C16H21BrO2/c17-14-12-10-8-6-4-2-1-3-5-7-9-11-13-16(19)15-18/h3,5,12,14,16,18-19H,1-2,4,6,8,10,15H2/b5-3-,14-12+/t16-/m1/s1 |
| InChIKey | CLUHNURDRVTBII-QBOVHYABSA-N |
| XLogP | 3.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|