About (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide
(E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide (PubChem CID 51051073) has the molecular formula C22H22N2O4
and a molecular weight of 378.43 g/mol. Its IUPAC name is (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide |
| PubChem CID | 51051073 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)C(=O)CC1(CCN(Cc3ccccc3)C1)O2)NO |
| InChI | InChI=1S/C22H22N2O4/c25-19-13-22(10-11-24(15-22)14-17-4-2-1-3-5-17)28-20-8-6-16(12-18(19)20)7-9-21(26)23-27/h1-9,12,27H,10-11,13-15H2,(H,23,26)/b9-7+ |
| InChIKey | TWTUJMUGLFWIIG-VQHVLOKHSA-N |
| XLogP | 2.82 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide?
The IUPAC name of (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide (CID 51051073) is (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide.
What is the SMILES notation for (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide?
The canonical SMILES for (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide is O=C(/C=C/c1ccc2c(c1)C(=O)CC1(CCN(Cc3ccccc3)C1)O2)NO.
What is the InChIKey of (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide?
The InChIKey is TWTUJMUGLFWIIG-VQHVLOKHSA-N. The full InChI is InChI=1S/C22H22N2O4/c25-19-13-22(10-11-24(15-22)14-17-4-2-1-3-5-17)28-20-8-6-16(12-18(19)20)7-9-21(26)23-27/h1-9,12,27H,10-11,13-15H2,(H,23,26)/b9-7+.
What are the key properties of (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide?
(E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide has a molecular weight of 378.43 g/mol, XLogP of 2.82, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1'-benzyl-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl)-N-hydroxyprop-2-enamide is sourced from PubChem (CID 51051073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).