C16H21NO5 — CID 51051204
benzyl (E)-3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]prop-2-enoate (PubChem CID 51051204) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is benzyl (E)-3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]prop-2-enoate.
| Compound Name | benzyl (E)-3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 51051204 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | benzyl (E)-3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]prop-2-enoate |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)N/C=C/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO5/c1-16(2,11-18)14(20)15(21)17-9-8-13(19)22-10-12-6-4-3-5-7-12/h3-9,14,18,20H,10-11H2,1-2H3,(H,17,21)/b9-8+/t14-/m0/s1 |
| InChIKey | MFPUBRLIWYOEIN-VFNNOXKTSA-N |
| XLogP | 0.74 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|