C19H21N5O — CID 51052476
4-propan-2-yl-N-(pyridin-2-ylmethyl)-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-8-carboxamide (PubChem CID 51052476) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 4-propan-2-yl-N-(pyridin-2-ylmethyl)-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-8-carboxamide.
| Compound Name | 4-propan-2-yl-N-(pyridin-2-ylmethyl)-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 51052476 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-propan-2-yl-N-(pyridin-2-ylmethyl)-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-8-carboxamide |
| SMILES | CC(C)n1ncc2c(C(=O)NCc3ccccn3)c3c(nc21)CCC3 |
| InChI | InChI=1S/C19H21N5O/c1-12(2)24-18-15(11-22-24)17(14-7-5-8-16(14)23-18)19(25)21-10-13-6-3-4-9-20-13/h3-4,6,9,11-12H,5,7-8,10H2,1-2H3,(H,21,25) |
| InChIKey | OOZDGIMGVBWUKT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |