C15H16Cl2N4O4 — CID 51053236
3-[(2,6-dichlorophenyl)methyl]-N-[2-(2-methoxyethylamino)-2-oxoethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 51053236) has the molecular formula C15H16Cl2N4O4 and a molecular weight of 387.22 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl]-N-[2-(2-methoxyethylamino)-2-oxoethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(2,6-dichlorophenyl)methyl]-N-[2-(2-methoxyethylamino)-2-oxoethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 51053236 |
| Molecular Formula | C15H16Cl2N4O4 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl]-N-[2-(2-methoxyethylamino)-2-oxoethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COCCNC(=O)CNC(=O)c1nc(Cc2c(Cl)cccc2Cl)no1 |
| InChI | InChI=1S/C15H16Cl2N4O4/c1-24-6-5-18-13(22)8-19-14(23)15-20-12(21-25-15)7-9-10(16)3-2-4-11(9)17/h2-4H,5-8H2,1H3,(H,18,22)(H,19,23) |
| InChIKey | DOUKPJNSKKZEMV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|