C13H16N2O3S2 — CID 51053850
3-methyl-5-(5-piperidin-1-ylsulfonylthiophen-3-yl)-1,2-oxazole (PubChem CID 51053850) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 3-methyl-5-(5-piperidin-1-ylsulfonylthiophen-3-yl)-1,2-oxazole.
| Compound Name | 3-methyl-5-(5-piperidin-1-ylsulfonylthiophen-3-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 51053850 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-methyl-5-(5-piperidin-1-ylsulfonylthiophen-3-yl)-1,2-oxazole |
| SMILES | Cc1cc(-c2csc(S(=O)(=O)N3CCCCC3)c2)on1 |
| InChI | InChI=1S/C13H16N2O3S2/c1-10-7-12(18-14-10)11-8-13(19-9-11)20(16,17)15-5-3-2-4-6-15/h7-9H,2-6H2,1H3 |
| InChIKey | XDUNGAMPLOGINY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |