About N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide
N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide (PubChem CID 51053905) has the molecular formula C20H20N4O2
and a molecular weight of 348.41 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide.
Molecular Properties
| Compound Name | N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide |
| PubChem CID | 51053905 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)C(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C20H20N4O2/c25-19(20(26)23-18-12-14-22-24-18)21-13-11-17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,12,14,17H,11,13H2,(H,21,25)(H2,22,23,24,26) |
| InChIKey | CPPMMGPYKURPTH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide?
The IUPAC name of N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide (CID 51053905) is N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide.
What is the SMILES notation for N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide?
The canonical SMILES for N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide is O=C(NCCC(c1ccccc1)c1ccccc1)C(=O)Nc1ccn[nH]1.
What is the InChIKey of N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide?
The InChIKey is CPPMMGPYKURPTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O2/c25-19(20(26)23-18-12-14-22-24-18)21-13-11-17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,12,14,17H,11,13H2,(H,21,25)(H2,22,23,24,26).
What are the key properties of N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide?
N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide has a molecular weight of 348.41 g/mol, XLogP of 2.69, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-diphenylpropyl)-N'-(1H-pyrazol-5-yl)oxamide is sourced from PubChem (CID 51053905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).