C16H23N3O4 — CID 51054457
6-[[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)acetyl]amino]hexanoic acid (PubChem CID 51054457) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 6-[[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 51054457 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 6-[[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)Cn1nc2c(cc1=O)CCCC2 |
| InChI | InChI=1S/C16H23N3O4/c20-14(17-9-5-1-2-8-16(22)23)11-19-15(21)10-12-6-3-4-7-13(12)18-19/h10H,1-9,11H2,(H,17,20)(H,22,23) |
| InChIKey | FCATYFJMMVGIES-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|