C19H30N4O2 — CID 51054870
6-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 51054870) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 6-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | 6-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 51054870 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 6-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | CC1CCc2[nH]c(=O)c(C(=O)NCCCN3CCN(C)CC3)cc2C1 |
| InChI | InChI=1S/C19H30N4O2/c1-14-4-5-17-15(12-14)13-16(19(25)21-17)18(24)20-6-3-7-23-10-8-22(2)9-11-23/h13-14H,3-12H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | PTLMOAYOKCMLDG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|