C30H26Si — CID 5105497
1,1-dimethyl-2,3,4,5-tetraphenylsilole (PubChem CID 5105497) has the molecular formula C30H26Si and a molecular weight of 414.62 g/mol. Its IUPAC name is 1,1-dimethyl-2,3,4,5-tetraphenylsilole.
| Compound Name | 1,1-dimethyl-2,3,4,5-tetraphenylsilole |
|---|---|
| PubChem CID | 5105497 |
| Molecular Formula | C30H26Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1,1-dimethyl-2,3,4,5-tetraphenylsilole |
| SMILES | C[Si]1(C)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C30H26Si/c1-31(2)29(25-19-11-5-12-20-25)27(23-15-7-3-8-16-23)28(24-17-9-4-10-18-24)30(31)26-21-13-6-14-22-26/h3-22H,1-2H3 |
| InChIKey | KTCXDIGJYUOQBJ-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|