C24H39NO7 — CID 51055156
(1S,2R,3R,4S,6S,8R,9R,10S,13S,16S,17R,18S)-11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,9,16-tetrol (PubChem CID 51055156) has the molecular formula C24H39NO7 and a molecular weight of 453.58 g/mol. Its IUPAC name is (1S,2R,3R,4S,6S,8R,9R,10S,13S,16S,17R,18S)-11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,9,16-tetrol.
| Compound Name | (1S,2R,3R,4S,6S,8R,9R,10S,13S,16S,17R,18S)-11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,9,16-tetrol |
|---|---|
| PubChem CID | 51055156 |
| Molecular Formula | C24H39NO7 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (1S,2R,3R,4S,6S,8R,9R,10S,13S,16S,17R,18S)-11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,9,16-tetrol |
| SMILES | CCN1C[C@]2(COC)CC[C@H](O)[C@@]34[C@@H]5CC6[C@@H](OC)C[C@@](O)([C@H]5[C@H]6O)[C@](O)([C@@H](OC)[C@H]23)[C@@H]14 |
| InChI | InChI=1S/C24H39NO7/c1-5-25-10-21(11-30-2)7-6-15(26)23-13-8-12-14(31-3)9-22(28,16(13)17(12)27)24(29,20(23)25)19(32-4)18(21)23/h12-20,26-29H,5-11H2,1-4H3/t12?,13-,14+,15+,16-,17+,18-,19+,20+,21+,22-,23+,24+/m1/s1 |
| InChIKey | BMZNJVXOLCBDPZ-RMFXMSQNSA-N |
| XLogP | -0.38 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |