C13H17NO — CID 51055187
(1R,3R,7aS)-3-ethenyl-3-hydroxy-7a-methyl-2,5,6,7-tetrahydro-1H-indene-1-carbonitrile (PubChem CID 51055187) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is (1R,3R,7aS)-3-ethenyl-3-hydroxy-7a-methyl-2,5,6,7-tetrahydro-1H-indene-1-carbonitrile.
| Compound Name | (1R,3R,7aS)-3-ethenyl-3-hydroxy-7a-methyl-2,5,6,7-tetrahydro-1H-indene-1-carbonitrile |
|---|---|
| PubChem CID | 51055187 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (1R,3R,7aS)-3-ethenyl-3-hydroxy-7a-methyl-2,5,6,7-tetrahydro-1H-indene-1-carbonitrile |
| SMILES | C=C[C@]1(O)C[C@@H](C#N)[C@]2(C)CCCC=C12 |
| InChI | InChI=1S/C13H17NO/c1-3-13(15)8-10(9-14)12(2)7-5-4-6-11(12)13/h3,6,10,15H,1,4-5,7-8H2,2H3/t10-,12-,13-/m0/s1 |
| InChIKey | ORKPZPIUJSARBE-DRZSPHRISA-N |
| XLogP | 2.56 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|