(2R,3R)-2,5-diamino-3-methylpentanoic acid

C6H14N2O2 — CID 51055215

IUPAC(2R,3R)-2,5-diamino-3-methylpentanoic acid
SMILESC[C@H](CCN)[C@@H](N)C(=O)O
InChIInChI=1S/C6H14N2O2/c1-4(2-3-7)5(8)6(9)10/h4-5H,2-3,7-8H2,1H3,(H,9,10)/t4-,5-/m1/s1
InChIKeyHYUPFEBCCJWDJX-RFZPGFLSSA-N
MW146.19 g/mol
LogP-0.62
Rot. Bonds4

About (2R,3R)-2,5-diamino-3-methylpentanoic acid

(2R,3R)-2,5-diamino-3-methylpentanoic acid (PubChem CID 51055215) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (2R,3R)-2,5-diamino-3-methylpentanoic acid.

Molecular Properties

Compound Name(2R,3R)-2,5-diamino-3-methylpentanoic acid
PubChem CID51055215
Molecular FormulaC6H14N2O2
Molecular Weight146.19 g/mol
Exact Mass146.11
IUPAC Name(2R,3R)-2,5-diamino-3-methylpentanoic acid
SMILESC[C@H](CCN)[C@@H](N)C(=O)O
InChIInChI=1S/C6H14N2O2/c1-4(2-3-7)5(8)6(9)10/h4-5H,2-3,7-8H2,1H3,(H,9,10)/t4-,5-/m1/s1
InChIKeyHYUPFEBCCJWDJX-RFZPGFLSSA-N
XLogP-0.62
TPSA89.34 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.19
LogP ≤ 5-0.62
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2R,3R)-2,5-diamino-3-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3R)-2,5-diamino-3-methylpentanoic acid?
The IUPAC name of (2R,3R)-2,5-diamino-3-methylpentanoic acid (CID 51055215) is (2R,3R)-2,5-diamino-3-methylpentanoic acid.
What is the SMILES notation for (2R,3R)-2,5-diamino-3-methylpentanoic acid?
The canonical SMILES for (2R,3R)-2,5-diamino-3-methylpentanoic acid is C[C@H](CCN)[C@@H](N)C(=O)O.
What is the InChIKey of (2R,3R)-2,5-diamino-3-methylpentanoic acid?
The InChIKey is HYUPFEBCCJWDJX-RFZPGFLSSA-N. The full InChI is InChI=1S/C6H14N2O2/c1-4(2-3-7)5(8)6(9)10/h4-5H,2-3,7-8H2,1H3,(H,9,10)/t4-,5-/m1/s1.
What are the key properties of (2R,3R)-2,5-diamino-3-methylpentanoic acid?
(2R,3R)-2,5-diamino-3-methylpentanoic acid has a molecular weight of 146.19 g/mol, XLogP of -0.62, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2,5-diamino-3-methylpentanoic acid is sourced from PubChem (CID 51055215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).