About 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol
2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol (PubChem CID 51055697) has the molecular formula C20H27N3O
and a molecular weight of 325.46 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol |
| PubChem CID | 51055697 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol |
| SMILES | CC(C)(C)c1cc(N2Nc3ccccc3N2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H27N3O/c1-19(2,3)13-11-14(20(4,5)6)18(24)17(12-13)23-21-15-9-7-8-10-16(15)22-23/h7-12,21-22,24H,1-6H3 |
| InChIKey | DISILMJZTGTMSG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol?
The IUPAC name of 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol (CID 51055697) is 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol.
What is the SMILES notation for 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol?
The canonical SMILES for 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol is CC(C)(C)c1cc(N2Nc3ccccc3N2)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol?
The InChIKey is DISILMJZTGTMSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O/c1-19(2,3)13-11-14(20(4,5)6)18(24)17(12-13)23-21-15-9-7-8-10-16(15)22-23/h7-12,21-22,24H,1-6H3.
What are the key properties of 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol?
2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol has a molecular weight of 325.46 g/mol, XLogP of 5.16, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-6-(1,3-dihydrobenzotriazol-2-yl)phenol is sourced from PubChem (CID 51055697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).