C14H20F3NO6 — CID 51055883
N-[(3aR,5S,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2,2,2-trifluoroacetamide (PubChem CID 51055883) has the molecular formula C14H20F3NO6 and a molecular weight of 355.31 g/mol. Its IUPAC name is N-[(3aR,5S,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3aR,5S,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 51055883 |
| Molecular Formula | C14H20F3NO6 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[(3aR,5S,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC1(C)OCC([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2NC(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C14H20F3NO6/c1-12(2)20-5-6(22-12)8-7(18-11(19)14(15,16)17)9-10(21-8)24-13(3,4)23-9/h6-10H,5H2,1-4H3,(H,18,19)/t6?,7-,8+,9+,10+/m0/s1 |
| InChIKey | BPJQTFCUDMTMHX-DEMCRKGTSA-N |
| XLogP | 1.06 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |