C25H32ClNO3 — CID 51056111
3-[[2-[2,4-bis(2,2-dimethylpropyl)phenoxy]acetyl]amino]benzoyl chloride (PubChem CID 51056111) has the molecular formula C25H32ClNO3 and a molecular weight of 429.99 g/mol. Its IUPAC name is 3-[[2-[2,4-bis(2,2-dimethylpropyl)phenoxy]acetyl]amino]benzoyl chloride.
| Compound Name | 3-[[2-[2,4-bis(2,2-dimethylpropyl)phenoxy]acetyl]amino]benzoyl chloride |
|---|---|
| PubChem CID | 51056111 |
| Molecular Formula | C25H32ClNO3 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 3-[[2-[2,4-bis(2,2-dimethylpropyl)phenoxy]acetyl]amino]benzoyl chloride |
| SMILES | CC(C)(C)Cc1ccc(OCC(=O)Nc2cccc(C(=O)Cl)c2)c(CC(C)(C)C)c1 |
| InChI | InChI=1S/C25H32ClNO3/c1-24(2,3)14-17-10-11-21(19(12-17)15-25(4,5)6)30-16-22(28)27-20-9-7-8-18(13-20)23(26)29/h7-13H,14-16H2,1-6H3,(H,27,28) |
| InChIKey | HXGWZVSIDBWHFX-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|