About 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole
7-hexoxy-4,5-dihydro-1H-benzo[g]indazole (PubChem CID 51056150) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole.
Molecular Properties
| Compound Name | 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole |
| PubChem CID | 51056150 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole |
| SMILES | CCCCCCOc1ccc2c(c1)CCc1cn[nH]c1-2 |
| InChI | InChI=1S/C17H22N2O/c1-2-3-4-5-10-20-15-8-9-16-13(11-15)6-7-14-12-18-19-17(14)16/h8-9,11-12H,2-7,10H2,1H3,(H,18,19) |
| InChIKey | ROWRUKGDJRPINO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole?
The IUPAC name of 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole (CID 51056150) is 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole.
What is the SMILES notation for 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole?
The canonical SMILES for 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole is CCCCCCOc1ccc2c(c1)CCc1cn[nH]c1-2.
What is the InChIKey of 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole?
The InChIKey is ROWRUKGDJRPINO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O/c1-2-3-4-5-10-20-15-8-9-16-13(11-15)6-7-14-12-18-19-17(14)16/h8-9,11-12H,2-7,10H2,1H3,(H,18,19).
What are the key properties of 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole?
7-hexoxy-4,5-dihydro-1H-benzo[g]indazole has a molecular weight of 270.38 g/mol, XLogP of 4.13, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hexoxy-4,5-dihydro-1H-benzo[g]indazole is sourced from PubChem (CID 51056150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).