C22H11F5N2O2 — CID 51056470
1-[7-(2,3,4,5,6-pentafluorobenzoyl)-3-phenylpyrrolo[1,2-c]pyrimidin-5-yl]ethanone (PubChem CID 51056470) has the molecular formula C22H11F5N2O2 and a molecular weight of 430.33 g/mol. Its IUPAC name is 1-[7-(2,3,4,5,6-pentafluorobenzoyl)-3-phenylpyrrolo[1,2-c]pyrimidin-5-yl]ethanone.
| Compound Name | 1-[7-(2,3,4,5,6-pentafluorobenzoyl)-3-phenylpyrrolo[1,2-c]pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 51056470 |
| Molecular Formula | C22H11F5N2O2 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 1-[7-(2,3,4,5,6-pentafluorobenzoyl)-3-phenylpyrrolo[1,2-c]pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)c1cc(C(=O)c2c(F)c(F)c(F)c(F)c2F)n2cnc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C22H11F5N2O2/c1-10(30)12-7-15(22(31)16-17(23)19(25)21(27)20(26)18(16)24)29-9-28-13(8-14(12)29)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | SHMYIAXLGCFWSN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|