About [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate
[6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate (PubChem CID 51056684) has the molecular formula C21H15ClN2O6S
and a molecular weight of 458.88 g/mol. Its IUPAC name is [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate |
| PubChem CID | 51056684 |
| Molecular Formula | C21H15ClN2O6S |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate |
| SMILES | CN(C)C(=O)c1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)c1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C21H15ClN2O6S/c1-23(2)19(25)15-10-11-17-18-14(15)4-3-5-16(18)20(26)24(21(17)27)30-31(28,29)13-8-6-12(22)7-9-13/h3-11H,1-2H3 |
| InChIKey | UESPTBYDXHFRGU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate?
The IUPAC name of [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate (CID 51056684) is [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate.
What is the SMILES notation for [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate?
The canonical SMILES for [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate is CN(C)C(=O)c1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)c1ccc(Cl)cc1)C2=O.
What is the InChIKey of [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate?
The InChIKey is UESPTBYDXHFRGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClN2O6S/c1-23(2)19(25)15-10-11-17-18-14(15)4-3-5-16(18)20(26)24(21(17)27)30-31(28,29)13-8-6-12(22)7-9-13/h3-11H,1-2H3.
What are the key properties of [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate?
[6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate has a molecular weight of 458.88 g/mol, XLogP of 3.11, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(dimethylcarbamoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-chlorobenzenesulfonate is sourced from PubChem (CID 51056684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).