C23H16FN3O5 — CID 51056800
ethyl 3-(4-fluorophenyl)-7-(3-nitrobenzoyl)pyrrolo[1,2-c]pyrimidine-5-carboxylate (PubChem CID 51056800) has the molecular formula C23H16FN3O5 and a molecular weight of 433.40 g/mol. Its IUPAC name is ethyl 3-(4-fluorophenyl)-7-(3-nitrobenzoyl)pyrrolo[1,2-c]pyrimidine-5-carboxylate.
| Compound Name | ethyl 3-(4-fluorophenyl)-7-(3-nitrobenzoyl)pyrrolo[1,2-c]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 51056800 |
| Molecular Formula | C23H16FN3O5 |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | ethyl 3-(4-fluorophenyl)-7-(3-nitrobenzoyl)pyrrolo[1,2-c]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)c2cccc([N+](=O)[O-])c2)n2cnc(-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C23H16FN3O5/c1-2-32-23(29)18-11-21(22(28)15-4-3-5-17(10-15)27(30)31)26-13-25-19(12-20(18)26)14-6-8-16(24)9-7-14/h3-13H,2H2,1H3 |
| InChIKey | OBOUXOJVSCFFPB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|