About 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide
4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide (PubChem CID 51056842) has the molecular formula C5H5N5O2
and a molecular weight of 167.13 g/mol. Its IUPAC name is 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide.
Molecular Properties
| Compound Name | 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide |
| PubChem CID | 51056842 |
| Molecular Formula | C5H5N5O2 |
| Molecular Weight | 167.13 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide |
| SMILES | N#CC1C(=O)NN=C1C(=O)NN |
| InChI | InChI=1S/C5H5N5O2/c6-1-2-3(5(12)8-7)9-10-4(2)11/h2H,7H2,(H,8,12)(H,10,11) |
| InChIKey | KSDWUMBGKIUPJK-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.13 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide?
The IUPAC name of 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide (CID 51056842) is 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide.
What is the SMILES notation for 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide?
The canonical SMILES for 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide is N#CC1C(=O)NN=C1C(=O)NN.
What is the InChIKey of 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide?
The InChIKey is KSDWUMBGKIUPJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5O2/c6-1-2-3(5(12)8-7)9-10-4(2)11/h2H,7H2,(H,8,12)(H,10,11).
What are the key properties of 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide?
4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide has a molecular weight of 167.13 g/mol, XLogP of -2.40, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-5-oxo-1,4-dihydropyrazole-3-carbohydrazide is sourced from PubChem (CID 51056842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).