About 10-phenylphenoxazine
10-phenylphenoxazine (PubChem CID 5105692) has the molecular formula C18H13NO
and a molecular weight of 259.31 g/mol. Its IUPAC name is 10-phenylphenoxazine.
Molecular Properties
| Compound Name | 10-phenylphenoxazine |
| PubChem CID | 5105692 |
| Molecular Formula | C18H13NO |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 10-phenylphenoxazine |
| SMILES | c1ccc(N2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C18H13NO/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-13H |
| InChIKey | LAVLDGSVWFEKJG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-phenylphenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-phenylphenoxazine?
The IUPAC name of 10-phenylphenoxazine (CID 5105692) is 10-phenylphenoxazine.
What is the SMILES notation for 10-phenylphenoxazine?
The canonical SMILES for 10-phenylphenoxazine is c1ccc(N2c3ccccc3Oc3ccccc32)cc1.
What is the InChIKey of 10-phenylphenoxazine?
The InChIKey is LAVLDGSVWFEKJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-13H.
What are the key properties of 10-phenylphenoxazine?
10-phenylphenoxazine has a molecular weight of 259.31 g/mol, XLogP of 5.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-phenylphenoxazine is sourced from PubChem (CID 5105692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).