About 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol
4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol (PubChem CID 510585) has the molecular formula C14H13NO3S
and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol.
Molecular Properties
| Compound Name | 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol |
| PubChem CID | 510585 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol |
| SMILES | CN1C(c2ccc(O)cc2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C14H13NO3S/c1-15-14(10-6-8-11(16)9-7-10)12-4-2-3-5-13(12)19(15,17)18/h2-9,14,16H,1H3 |
| InChIKey | RVUSNJHQKZUJCT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol?
The IUPAC name of 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol (CID 510585) is 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol.
What is the SMILES notation for 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol?
The canonical SMILES for 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol is CN1C(c2ccc(O)cc2)c2ccccc2S1(=O)=O.
What is the InChIKey of 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol?
The InChIKey is RVUSNJHQKZUJCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO3S/c1-15-14(10-6-8-11(16)9-7-10)12-4-2-3-5-13(12)19(15,17)18/h2-9,14,16H,1H3.
What are the key properties of 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol?
4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol has a molecular weight of 275.33 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl)phenol is sourced from PubChem (CID 510585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).