C16H21NO5 — CID 51058701
5-[(2Z,4E)-2-hydroxy-5-piperidin-1-ylpenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 51058701) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-[(2Z,4E)-2-hydroxy-5-piperidin-1-ylpenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2Z,4E)-2-hydroxy-5-piperidin-1-ylpenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 51058701 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 5-[(2Z,4E)-2-hydroxy-5-piperidin-1-ylpenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C/C(O)=C/C=C/N2CCCCC2)C(=O)O1 |
| InChI | InChI=1S/C16H21NO5/c1-16(2)21-14(19)13(15(20)22-16)11-12(18)7-6-10-17-8-4-3-5-9-17/h6-7,10-11,18H,3-5,8-9H2,1-2H3/b10-6+,12-7- |
| InChIKey | BXTKDOZXIDWPGQ-NGSBCVAZSA-N |
| XLogP | 2.19 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|