C13H10ClNO2S — CID 510598
3-(3-chlorophenyl)-2,3-dihydro-1,2-benzothiazole 1,1-dioxide (PubChem CID 510598) has the molecular formula C13H10ClNO2S and a molecular weight of 279.75 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2,3-dihydro-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-(3-chlorophenyl)-2,3-dihydro-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 510598 |
| Molecular Formula | C13H10ClNO2S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 3-(3-chlorophenyl)-2,3-dihydro-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)NC(c2cccc(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C13H10ClNO2S/c14-10-5-3-4-9(8-10)13-11-6-1-2-7-12(11)18(16,17)15-13/h1-8,13,15H |
| InChIKey | QMAGHQNHLWPMSP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |