About ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate
ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate (PubChem CID 51060030) has the molecular formula C18H16F2O2
and a molecular weight of 302.32 g/mol. Its IUPAC name is ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate |
| PubChem CID | 51060030 |
| Molecular Formula | C18H16F2O2 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)c1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H16F2O2/c1-3-22-18(21)10-12(2)13-4-6-14(7-5-13)16-9-8-15(19)11-17(16)20/h4-11H,3H2,1-2H3/b12-10+ |
| InChIKey | NFDQLLITCOILEQ-ZRDIBKRKSA-N |
| XLogP | 4.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate?
The IUPAC name of ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate (CID 51060030) is ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate.
What is the SMILES notation for ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate?
The canonical SMILES for ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate is CCOC(=O)/C=C(\C)c1ccc(-c2ccc(F)cc2F)cc1.
What is the InChIKey of ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate?
The InChIKey is NFDQLLITCOILEQ-ZRDIBKRKSA-N. The full InChI is InChI=1S/C18H16F2O2/c1-3-22-18(21)10-12(2)13-4-6-14(7-5-13)16-9-8-15(19)11-17(16)20/h4-11H,3H2,1-2H3/b12-10+.
What are the key properties of ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate?
ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate has a molecular weight of 302.32 g/mol, XLogP of 4.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-[4-(2,4-difluorophenyl)phenyl]but-2-enoate is sourced from PubChem (CID 51060030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).