C28H23ClN2O4 — CID 51060191
[1-[(E)-[[2-(3,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate (PubChem CID 51060191) has the molecular formula C28H23ClN2O4 and a molecular weight of 486.96 g/mol. Its IUPAC name is [1-[(E)-[[2-(3,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate.
| Compound Name | [1-[(E)-[[2-(3,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 51060191 |
| Molecular Formula | C28H23ClN2O4 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [1-[(E)-[[2-(3,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate |
| SMILES | Cc1ccc(OCC(=O)N/N=C/c2c(OC(=O)c3ccc(Cl)cc3)ccc3ccccc23)cc1C |
| InChI | InChI=1S/C28H23ClN2O4/c1-18-7-13-23(15-19(18)2)34-17-27(32)31-30-16-25-24-6-4-3-5-20(24)10-14-26(25)35-28(33)21-8-11-22(29)12-9-21/h3-16H,17H2,1-2H3,(H,31,32)/b30-16+ |
| InChIKey | ZRLDIXXAVBHQSS-OKCVXOCRSA-N |
| XLogP | 5.86 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|