C19H20BrN3O4 — CID 51061179
N'-[(E)-(5-bromo-2-propoxyphenyl)methylideneamino]-N-(4-methoxyphenyl)oxamide (PubChem CID 51061179) has the molecular formula C19H20BrN3O4 and a molecular weight of 434.29 g/mol. Its IUPAC name is N'-[(E)-(5-bromo-2-propoxyphenyl)methylideneamino]-N-(4-methoxyphenyl)oxamide.
| Compound Name | N'-[(E)-(5-bromo-2-propoxyphenyl)methylideneamino]-N-(4-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 51061179 |
| Molecular Formula | C19H20BrN3O4 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | N'-[(E)-(5-bromo-2-propoxyphenyl)methylideneamino]-N-(4-methoxyphenyl)oxamide |
| SMILES | CCCOc1ccc(Br)cc1/C=N/NC(=O)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H20BrN3O4/c1-3-10-27-17-9-4-14(20)11-13(17)12-21-23-19(25)18(24)22-15-5-7-16(26-2)8-6-15/h4-9,11-12H,3,10H2,1-2H3,(H,22,24)(H,23,25)/b21-12+ |
| InChIKey | IXFXPCXCWHXTTM-CIAFOILYSA-N |
| XLogP | 3.34 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|