About 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide
5-oxo-1,2-diphenylpyrrolidine-2-carboxamide (PubChem CID 5106131) has the molecular formula C17H16N2O2
and a molecular weight of 280.33 g/mol. Its IUPAC name is 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide |
| PubChem CID | 5106131 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1(c2ccccc2)CCC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C17H16N2O2/c18-16(21)17(13-7-3-1-4-8-13)12-11-15(20)19(17)14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,18,21) |
| InChIKey | GZAVLEXURAJULI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide?
The IUPAC name of 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide (CID 5106131) is 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide.
What is the SMILES notation for 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide?
The canonical SMILES for 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide is NC(=O)C1(c2ccccc2)CCC(=O)N1c1ccccc1.
What is the InChIKey of 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide?
The InChIKey is GZAVLEXURAJULI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2/c18-16(21)17(13-7-3-1-4-8-13)12-11-15(20)19(17)14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,18,21).
What are the key properties of 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide?
5-oxo-1,2-diphenylpyrrolidine-2-carboxamide has a molecular weight of 280.33 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-1,2-diphenylpyrrolidine-2-carboxamide is sourced from PubChem (CID 5106131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).