About 1-phenyl-4,5-dihydroimidazole;hydroiodide
1-phenyl-4,5-dihydroimidazole;hydroiodide (PubChem CID 51062680) has the molecular formula C9H11IN2
and a molecular weight of 274.10 g/mol. Its IUPAC name is 1-phenyl-4,5-dihydroimidazole;hydroiodide.
Molecular Properties
| Compound Name | 1-phenyl-4,5-dihydroimidazole;hydroiodide |
| PubChem CID | 51062680 |
| Molecular Formula | C9H11IN2 |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 1-phenyl-4,5-dihydroimidazole;hydroiodide |
| SMILES | C1=NCCN1c1ccccc1.I |
| InChI | InChI=1S/C9H10N2.HI/c1-2-4-9(5-3-1)11-7-6-10-8-11;/h1-5,8H,6-7H2;1H |
| InChIKey | YZDKOHIAUBGXFY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-4,5-dihydroimidazole;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-4,5-dihydroimidazole;hydroiodide?
The IUPAC name of 1-phenyl-4,5-dihydroimidazole;hydroiodide (CID 51062680) is 1-phenyl-4,5-dihydroimidazole;hydroiodide.
What is the SMILES notation for 1-phenyl-4,5-dihydroimidazole;hydroiodide?
The canonical SMILES for 1-phenyl-4,5-dihydroimidazole;hydroiodide is C1=NCCN1c1ccccc1.I.
What is the InChIKey of 1-phenyl-4,5-dihydroimidazole;hydroiodide?
The InChIKey is YZDKOHIAUBGXFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.HI/c1-2-4-9(5-3-1)11-7-6-10-8-11;/h1-5,8H,6-7H2;1H.
What are the key properties of 1-phenyl-4,5-dihydroimidazole;hydroiodide?
1-phenyl-4,5-dihydroimidazole;hydroiodide has a molecular weight of 274.10 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-4,5-dihydroimidazole;hydroiodide is sourced from PubChem (CID 51062680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).