About (3-nitro-4-pyridinyl) 2-phenylethanesulfonate
(3-nitro-4-pyridinyl) 2-phenylethanesulfonate (PubChem CID 51063154) has the molecular formula C13H12N2O5S
and a molecular weight of 308.31 g/mol. Its IUPAC name is (3-nitro-4-pyridinyl) 2-phenylethanesulfonate.
Molecular Properties
| Compound Name | (3-nitro-4-pyridinyl) 2-phenylethanesulfonate |
| PubChem CID | 51063154 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | (3-nitro-4-pyridinyl) 2-phenylethanesulfonate |
| SMILES | O=[N+]([O-])c1cnccc1OS(=O)(=O)CCc1ccccc1 |
| InChI | InChI=1S/C13H12N2O5S/c16-15(17)12-10-14-8-6-13(12)20-21(18,19)9-7-11-4-2-1-3-5-11/h1-6,8,10H,7,9H2 |
| InChIKey | XLIFTUHZCOHLCK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 99.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-nitro-4-pyridinyl) 2-phenylethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitro-4-pyridinyl) 2-phenylethanesulfonate?
The IUPAC name of (3-nitro-4-pyridinyl) 2-phenylethanesulfonate (CID 51063154) is (3-nitro-4-pyridinyl) 2-phenylethanesulfonate.
What is the SMILES notation for (3-nitro-4-pyridinyl) 2-phenylethanesulfonate?
The canonical SMILES for (3-nitro-4-pyridinyl) 2-phenylethanesulfonate is O=[N+]([O-])c1cnccc1OS(=O)(=O)CCc1ccccc1.
What is the InChIKey of (3-nitro-4-pyridinyl) 2-phenylethanesulfonate?
The InChIKey is XLIFTUHZCOHLCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O5S/c16-15(17)12-10-14-8-6-13(12)20-21(18,19)9-7-11-4-2-1-3-5-11/h1-6,8,10H,7,9H2.
What are the key properties of (3-nitro-4-pyridinyl) 2-phenylethanesulfonate?
(3-nitro-4-pyridinyl) 2-phenylethanesulfonate has a molecular weight of 308.31 g/mol, XLogP of 1.94, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitro-4-pyridinyl) 2-phenylethanesulfonate is sourced from PubChem (CID 51063154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).