About 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one
2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one (PubChem CID 51063586) has the molecular formula C15H15BrN2O2
and a molecular weight of 335.20 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one |
| PubChem CID | 51063586 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one |
| SMILES | CC1(C)CC(=O)c2c(nc(-c3ccc(Br)cc3)n2O)C1 |
| InChI | InChI=1S/C15H15BrN2O2/c1-15(2)7-11-13(12(19)8-15)18(20)14(17-11)9-3-5-10(16)6-4-9/h3-6,20H,7-8H2,1-2H3 |
| InChIKey | ZDGWALQPHPVJIE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one?
The IUPAC name of 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one (CID 51063586) is 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one.
What is the SMILES notation for 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one?
The canonical SMILES for 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one is CC1(C)CC(=O)c2c(nc(-c3ccc(Br)cc3)n2O)C1.
What is the InChIKey of 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one?
The InChIKey is ZDGWALQPHPVJIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BrN2O2/c1-15(2)7-11-13(12(19)8-15)18(20)14(17-11)9-3-5-10(16)6-4-9/h3-6,20H,7-8H2,1-2H3.
What are the key properties of 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one?
2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one has a molecular weight of 335.20 g/mol, XLogP of 3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-3-hydroxy-6,6-dimethyl-5,7-dihydrobenzimidazol-4-one is sourced from PubChem (CID 51063586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).