C19H19NO5 — CID 51063603
(3Z)-3-[(3-ethoxy-2-hydroxyphenyl)methylidene]-5,6-dimethoxy-1H-indol-2-one (PubChem CID 51063603) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is (3Z)-3-[(3-ethoxy-2-hydroxyphenyl)methylidene]-5,6-dimethoxy-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3-ethoxy-2-hydroxyphenyl)methylidene]-5,6-dimethoxy-1H-indol-2-one |
|---|---|
| PubChem CID | 51063603 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (3Z)-3-[(3-ethoxy-2-hydroxyphenyl)methylidene]-5,6-dimethoxy-1H-indol-2-one |
| SMILES | CCOc1cccc(/C=C2\C(=O)Nc3cc(OC)c(OC)cc32)c1O |
| InChI | InChI=1S/C19H19NO5/c1-4-25-15-7-5-6-11(18(15)21)8-13-12-9-16(23-2)17(24-3)10-14(12)20-19(13)22/h5-10,21H,4H2,1-3H3,(H,20,22)/b13-8- |
| InChIKey | UBQOJFIEEPCHSC-JYRVWZFOSA-N |
| XLogP | 3.30 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|