4-cyclopropyl-1,3-thiazole-2-carboxylic acid

C7H7NO2S — CID 51063804

IUPAC4-cyclopropyl-1,3-thiazole-2-carboxylic acid
SMILESO=C(O)c1nc(C2CC2)cs1
InChIInChI=1S/C7H7NO2S/c9-7(10)6-8-5(3-11-6)4-1-2-4/h3-4H,1-2H2,(H,9,10)
InChIKeyWAAIEZKJACRUDB-UHFFFAOYSA-N
MW169.21 g/mol
LogP1.72
Rot. Bonds2

About 4-cyclopropyl-1,3-thiazole-2-carboxylic acid

4-cyclopropyl-1,3-thiazole-2-carboxylic acid (PubChem CID 51063804) has the molecular formula C7H7NO2S and a molecular weight of 169.21 g/mol. Its IUPAC name is 4-cyclopropyl-1,3-thiazole-2-carboxylic acid.

Molecular Properties

Compound Name4-cyclopropyl-1,3-thiazole-2-carboxylic acid
PubChem CID51063804
Molecular FormulaC7H7NO2S
Molecular Weight169.21 g/mol
Exact Mass169.02
IUPAC Name4-cyclopropyl-1,3-thiazole-2-carboxylic acid
SMILESO=C(O)c1nc(C2CC2)cs1
InChIInChI=1S/C7H7NO2S/c9-7(10)6-8-5(3-11-6)4-1-2-4/h3-4H,1-2H2,(H,9,10)
InChIKeyWAAIEZKJACRUDB-UHFFFAOYSA-N
XLogP1.72
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.21
LogP ≤ 51.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-cyclopropyl-1,3-thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-cyclopropyl-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 4-cyclopropyl-1,3-thiazole-2-carboxylic acid (CID 51063804) is 4-cyclopropyl-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 4-cyclopropyl-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 4-cyclopropyl-1,3-thiazole-2-carboxylic acid is O=C(O)c1nc(C2CC2)cs1.
What is the InChIKey of 4-cyclopropyl-1,3-thiazole-2-carboxylic acid?
The InChIKey is WAAIEZKJACRUDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2S/c9-7(10)6-8-5(3-11-6)4-1-2-4/h3-4H,1-2H2,(H,9,10).
What are the key properties of 4-cyclopropyl-1,3-thiazole-2-carboxylic acid?
4-cyclopropyl-1,3-thiazole-2-carboxylic acid has a molecular weight of 169.21 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 51063804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).