About 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol
6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol (PubChem CID 51063951) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol |
| PubChem CID | 51063951 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol |
| SMILES | OCc1cnc2n1CCC2 |
| InChI | InChI=1S/C7H10N2O/c10-5-6-4-8-7-2-1-3-9(6)7/h4,10H,1-3,5H2 |
| InChIKey | BDQHFHMDXRFNGB-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol?
The IUPAC name of 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol (CID 51063951) is 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol.
What is the SMILES notation for 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol?
The canonical SMILES for 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol is OCc1cnc2n1CCC2.
What is the InChIKey of 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol?
The InChIKey is BDQHFHMDXRFNGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c10-5-6-4-8-7-2-1-3-9(6)7/h4,10H,1-3,5H2.
What are the key properties of 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol?
6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol has a molecular weight of 138.17 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-ylmethanol is sourced from PubChem (CID 51063951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).